EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2 |
| Net Charge | 0 |
| Average Mass | 160.220 |
| Monoisotopic Mass | 160.10005 |
| SMILES | NCCc1cnc2ccccc12 |
| InChI | InChI=1S/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2 |
| InChIKey | APJYDQYYACXCRM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (222770225) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (24558969) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptamine (CHEBI:16765) has role human metabolite (CHEBI:77746) |
| tryptamine (CHEBI:16765) has role mouse metabolite (CHEBI:75771) |
| tryptamine (CHEBI:16765) has role plant metabolite (CHEBI:76924) |
| tryptamine (CHEBI:16765) is a aminoalkylindole (CHEBI:38631) |
| tryptamine (CHEBI:16765) is a aralkylamino compound (CHEBI:64365) |
| tryptamine (CHEBI:16765) is a indole alkaloid (CHEBI:38958) |
| tryptamine (CHEBI:16765) is a tryptamines (CHEBI:27162) |
| tryptamine (CHEBI:16765) is conjugate base of tryptaminium (CHEBI:57887) |
| Incoming Relation(s) |
| N-acetyltryptamine (CHEBI:55515) has functional parent tryptamine (CHEBI:16765) |
| N-methyltryptamine (CHEBI:28136) has functional parent tryptamine (CHEBI:16765) |
| N,N-dimethyltryptamine (CHEBI:28969) has functional parent tryptamine (CHEBI:16765) |
| baeocystin (CHEBI:139505) has functional parent tryptamine (CHEBI:16765) |
| luzindole (CHEBI:131788) has functional parent tryptamine (CHEBI:16765) |
| melatonin (CHEBI:16796) has functional parent tryptamine (CHEBI:16765) |
| norbaeocystin (CHEBI:139479) has functional parent tryptamine (CHEBI:16765) |
| serotonin (CHEBI:28790) has functional parent tryptamine (CHEBI:16765) |
| tryptaminium (CHEBI:57887) is conjugate acid of tryptamine (CHEBI:16765) |
| IUPAC Name |
|---|
| 2-(1H-indol-3-yl)ethanamine |
| Synonyms | Source |
|---|---|
| Tryptamine | KEGG COMPOUND |
| 3-(2-Aminoethyl)indole | KEGG COMPOUND |
| 1H-indole-3-ethanamine | NIST Chemistry WebBook |
| 2-(1H-INDOL-3-YL)ETHANAMINE | PDBeChem |
| 2-(3-indolyl)ethylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00398 | KEGG COMPOUND |
| TSS | PDBeChem |
| Tryptamine | Wikipedia |
| DB08653 | DrugBank |
| HMDB0000303 | HMDB |
| TRYPTAMINE | MetaCyc |
| C00001434 | KNApSAcK |
| Citations |
|---|