EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28969 - N,N-dimethyltryptamine
| Formula | C12H16N2 |
| Net Charge | 0 |
| Average Mass | 188.274 |
| Monoisotopic Mass | 188.13135 |
| SMILES | CN(C)CCc1cnc2ccccc12 |
| InChI | InChI=1S/C12H16N2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12/h3-6,9,13H,7-8H2,1-2H3 |
| InChIKey | DMULVCHRPCFFGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethyltryptamine (CHEBI:28969) has functional parent tryptamine (CHEBI:16765) |
| N,N-dimethyltryptamine (CHEBI:28969) is a tryptamine alkaloid (CHEBI:48274) |
| N,N-dimethyltryptamine (CHEBI:28969) is a tryptamines (CHEBI:27162) |
| N,N-dimethyltryptamine (CHEBI:28969) is conjugate base of N,N-dimethyltryptaminium (CHEBI:193124) |
| Incoming Relation(s) |
| bufotenin (CHEBI:3210) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| psilocin (CHEBI:8613) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| rizatriptan (CHEBI:48273) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| sumatriptan (CHEBI:10650) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| zolmitriptan (CHEBI:10124) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| N,N-dimethyltryptaminium (CHEBI:193124) is conjugate acid of N,N-dimethyltryptamine (CHEBI:28969) |
| IUPAC Name |
|---|
| 2-(1H-indol-3-yl)-N,N-dimethylethanamine |
| Synonyms | Source |
|---|---|
| N,N-Dimethyltryptamine | KEGG COMPOUND |
| 3-(2-dimethylaminoethyl)indole | ChemIDplus |
| N,N-dimethyl-1H-indole-3-ethylamine | ChemIDplus |
| 3-[2-(dimethylamino)ethyl]indole | NIST Chemistry WebBook |
| 2-(3-indolyl)ethyldimethylamine | NIST Chemistry WebBook |
| DMT | NIST Chemistry WebBook |