EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:139479 - norbaeocystin
| Formula | C10H13N2O4P |
| Net Charge | 0 |
| Average Mass | 256.198 |
| Monoisotopic Mass | 256.06129 |
| SMILES | NCCc1cnc2cccc(OP(=O)(O)O)c12 |
| InChI | InChI=1S/C10H13N2O4P/c11-5-4-7-6-12-8-2-1-3-9(10(7)8)16-17(13,14)15/h1-3,6,12H,4-5,11H2,(H2,13,14,15) |
| InChIKey | IKQGYCWFBVEAKF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pholiotina cyanopus (ncbitaxon:1276721) | - | PubMed (25826052) | |
| Psilocybe semilanceata (ncbitaxon:181775) | - | PubMed (25826052) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norbaeocystin (CHEBI:139479) has functional parent tryptamine (CHEBI:16765) |
| norbaeocystin (CHEBI:139479) has role fungal metabolite (CHEBI:76946) |
| norbaeocystin (CHEBI:139479) has role hallucinogen (CHEBI:35499) |
| norbaeocystin (CHEBI:139479) is a organic phosphate (CHEBI:25703) |
| norbaeocystin (CHEBI:139479) is a primary amino compound (CHEBI:50994) |
| norbaeocystin (CHEBI:139479) is a tryptamine alkaloid (CHEBI:48274) |
| norbaeocystin (CHEBI:139479) is conjugate acid of norbaeocystin(1−) (CHEBI:139070) |
| Incoming Relation(s) |
| norbaeocystin(1−) (CHEBI:139070) is conjugate base of norbaeocystin (CHEBI:139479) |
| IUPAC Name |
|---|
| 3-(2-aminoethyl)-1H-indol-4-yl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| 4-hydoxytryptamine 4-phosphate | MetaCyc |
| 4-hydoxytryptamine phosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-20577 | MetaCyc |
| Norbaeocystin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:421031 | Reaxys |
| CAS:21420-59-7 | ChemIDplus |
| Citations |
|---|