EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28136 - N-methyltryptamine
| Formula | C11H14N2 |
| Net Charge | 0 |
| Average Mass | 174.247 |
| Monoisotopic Mass | 174.11570 |
| SMILES | CNCCc1cnc2ccccc12 |
| InChI | InChI=1S/C11H14N2/c1-12-7-6-9-8-13-11-5-3-2-4-10(9)11/h2-5,8,12-13H,6-7H2,1H3 |
| InChIKey | NCIKQJBVUNUXLW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paramuricea clavata (ncbitaxon:317549) | - | PubMed (21939218) | CH2Cl2:MeOH(1:1) extract of lyophilized material |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyltryptamine (CHEBI:28136) has functional parent tryptamine (CHEBI:16765) |
| N-methyltryptamine (CHEBI:28136) has role metabolite (CHEBI:25212) |
| N-methyltryptamine (CHEBI:28136) is a tryptamine alkaloid (CHEBI:48274) |
| N-methyltryptamine (CHEBI:28136) is a tryptamines (CHEBI:27162) |
| N-methyltryptamine (CHEBI:28136) is conjugate base of N-methyltryptaminium (CHEBI:193123) |
| Incoming Relation(s) |
| N-methyltryptaminium (CHEBI:193123) is conjugate acid of N-methyltryptamine (CHEBI:28136) |
| IUPAC Name |
|---|
| 2-(1H-indol-3-yl)-N-methylethanamine |
| Synonyms | Source |
|---|---|
| N-Methyltryptamine | KEGG COMPOUND |
| Nω-methyltryptamine | NIST Chemistry WebBook |
| N-monomethyltryptamine | ChemIDplus |
| 3-(2-methylaminoethyl)indole | ChemIDplus |
| N-methyl-1H-indole-3-ethanamine | ChemIDplus |