EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16765 - tryptamine
| Formula | C10H12N2 |
| Net Charge | 0 |
| Average Mass | 160.220 |
| Monoisotopic Mass | 160.10005 |
| SMILES | NCCc1cnc2ccccc12 |
| InChI | InChI=1S/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2 |
| InChIKey | APJYDQYYACXCRM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (222770225) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (24558969) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tryptamine (CHEBI:16765) has role human metabolite (CHEBI:77746) |
| tryptamine (CHEBI:16765) has role mouse metabolite (CHEBI:75771) |
| tryptamine (CHEBI:16765) has role plant metabolite (CHEBI:76924) |
| tryptamine (CHEBI:16765) is a aminoalkylindole (CHEBI:38631) |
| tryptamine (CHEBI:16765) is a aralkylamino compound (CHEBI:64365) |
| tryptamine (CHEBI:16765) is a indole alkaloid (CHEBI:38958) |
| tryptamine (CHEBI:16765) is a tryptamines (CHEBI:27162) |
| tryptamine (CHEBI:16765) is conjugate base of tryptaminium (CHEBI:57887) |
| Incoming Relation(s) |
| N-acetyltryptamine (CHEBI:55515) has functional parent tryptamine (CHEBI:16765) |
| N-methyltryptamine (CHEBI:28136) has functional parent tryptamine (CHEBI:16765) |
| N,N-dimethyltryptamine (CHEBI:28969) has functional parent tryptamine (CHEBI:16765) |
| baeocystin (CHEBI:139505) has functional parent tryptamine (CHEBI:16765) |
| luzindole (CHEBI:131788) has functional parent tryptamine (CHEBI:16765) |
| melatonin (CHEBI:16796) has functional parent tryptamine (CHEBI:16765) |
| norbaeocystin (CHEBI:139479) has functional parent tryptamine (CHEBI:16765) |
| serotonin (CHEBI:28790) has functional parent tryptamine (CHEBI:16765) |
| tryptaminium (CHEBI:57887) is conjugate acid of tryptamine (CHEBI:16765) |
| IUPAC Name |
|---|
| 2-(1H-indol-3-yl)ethanamine |
| Synonyms | Source |
|---|---|
| 1H-indole-3-ethanamine | NIST Chemistry WebBook |
| 2-(1H-INDOL-3-YL)ETHANAMINE | PDBeChem |
| 2-(3-indolyl)ethylamine | ChemIDplus |
| 3-(2-Aminoethyl)indole | KEGG COMPOUND |
| Tryptamine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001434 | KNApSAcK |
| C00398 | KEGG COMPOUND |
| DB08653 | DrugBank |
| HMDB0000303 | HMDB |
| Tryptamine | Wikipedia |
| TRYPTAMINE | MetaCyc |
| TSS | PDBeChem |
| Citations |
|---|