EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:139505 - baeocystin
| Formula | C11H15N2O4P |
| Net Charge | 0 |
| Average Mass | 270.225 |
| Monoisotopic Mass | 270.07694 |
| SMILES | CNCCc1cnc2cccc(OP(=O)(O)O)c12 |
| InChI | InChI=1S/C11H15N2O4P/c1-12-6-5-8-7-13-9-3-2-4-10(11(8)9)17-18(14,15)16/h2-4,7,12-13H,5-6H2,1H3,(H2,14,15,16) |
| InChIKey | WTPBXXCVZZZXKR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Inocybe aeruginascens (ncbitaxon:755238) | fruit body (BTO:0000487) | PubMed (17269094) | |
| Psilocybe semilanceata (ncbitaxon:181775) | - | PubMed (17342589) | |
| Psilocybe samuiensis (ncbitaxon:381285) | - | PubMed (7967658) | |
| Panaeolus subbalteatus (ncbitaxon:209655) | - | PubMed (17342589) | |
| Psilocybe cyanescens (ncbitaxon:93625) | - | PubMed (600026) | |
| Psilocybe cubensis (ncbitaxon:181762) | - | PubMed (2614674) | |
| Pluteus salicinus (ncbitaxon:181533) | fruit body (BTO:0000487) | PubMed (17269025) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| baeocystin (CHEBI:139505) has functional parent tryptamine (CHEBI:16765) |
| baeocystin (CHEBI:139505) has role fungal metabolite (CHEBI:76946) |
| baeocystin (CHEBI:139505) has role hallucinogen (CHEBI:35499) |
| baeocystin (CHEBI:139505) is a organic phosphate (CHEBI:25703) |
| baeocystin (CHEBI:139505) is a secondary amino compound (CHEBI:50995) |
| baeocystin (CHEBI:139505) is a tryptamine alkaloid (CHEBI:48274) |
| baeocystin (CHEBI:139505) is conjugate acid of baeocystin(1−) (CHEBI:139071) |
| Incoming Relation(s) |
| baeocystin(1−) (CHEBI:139071) is conjugate base of baeocystin (CHEBI:139505) |
| IUPAC Name |
|---|
| 3-[2-(methylamino)ethyl]-1H-indol-4-yl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| 4-hydroxy-N-methyltryptamine phosphate | ChEBI |
| 4-hydroxy-N-methyltryptamine 4-phosphate | ChEBI |
| N-desmethylpsilocybin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-20579 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:488756 | Reaxys |
| CAS:21420-58-6 | ChemIDplus |
| Citations |
|---|