EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36431 - angelic acid
| Formula | C5H8O2 |
| Net Charge | 0 |
| Average Mass | 100.117 |
| Monoisotopic Mass | 100.05243 |
| SMILES | [H]/C(C)=C(\C)C(=O)O |
| InChI | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3- |
| InChIKey | UIERETOOQGIECD-ARJAWSKDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| angelic acid (CHEBI:36431) has functional parent isocrotonic acid (CHEBI:36253) |
| angelic acid (CHEBI:36431) has role plant metabolite (CHEBI:76924) |
| angelic acid (CHEBI:36431) is a 2-methylbut-2-enoic acid (CHEBI:36432) |
| Incoming Relation(s) |
| ananolignan M (CHEBI:67450) has functional parent angelic acid (CHEBI:36431) |
| ananolignan N (CHEBI:67451) has functional parent angelic acid (CHEBI:36431) |
| columbianadin (CHEBI:132624) has functional parent angelic acid (CHEBI:36431) |
| gordonoside I (CHEBI:67497) has functional parent angelic acid (CHEBI:36431) |
| gordonoside J (CHEBI:67498) has functional parent angelic acid (CHEBI:36431) |
| heliosupine (CHEBI:5641) has functional parent angelic acid (CHEBI:36431) |
| ingenol mebutate (CHEBI:66913) has functional parent angelic acid (CHEBI:36431) |
| interiotherin B (CHEBI:66083) has functional parent angelic acid (CHEBI:36431) |
| interiotherin C (CHEBI:67455) has functional parent angelic acid (CHEBI:36431) |
| luteolin 7-O-β-D-glucoside-4'-(Z-2-methyl-2-butenoate) (CHEBI:85149) has functional parent angelic acid (CHEBI:36431) |
| petasin (CHEBI:8030) has functional parent angelic acid (CHEBI:36431) |
| IUPAC Name |
|---|
| (2Z)-2-methylbut-2-enoic acid |
| Synonyms | Source |
|---|---|
| Angelic acid | ChemIDplus |
| cis-2-methyl-2-butenoic acid | NIST Chemistry WebBook |
| (Z)-2-methylcrotonic acid | NIST Chemistry WebBook |
| 2-methylisocrotonic acid | ChemIDplus |
| Angelicasäure | ChEBI |
| Angelikasäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020029 | LIPID MAPS |
| HMDB0029608 | HMDB |
| Angelic_acid | Wikipedia |
| US4613680 | Patent |
| Citations |
|---|