EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O9 |
| Net Charge | 0 |
| Average Mass | 498.528 |
| Monoisotopic Mass | 498.18898 |
| SMILES | C/C=C(/C)C(=O)O[C@H]1c2cc3c(c(OC)c2-c2c(cc4c(c2OC)OCO4)C[C@H](C)[C@]1(C)O)OCO3 |
| InChI | InChI=1S/C27H30O9/c1-7-13(2)26(28)36-25-16-10-18-22(35-12-33-18)24(31-6)20(16)19-15(8-14(3)27(25,4)29)9-17-21(23(19)30-5)34-11-32-17/h7,9-10,14,25,29H,8,11-12H2,1-6H3/b13-7-/t14-,25-,27-/m0/s1 |
| InChIKey | KIOQRWNZGHZFHB-UFZBKZSQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura interior (IPNI:554578-1) | stem (BTO:0001300) | PubMed (8946749) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| interiotherin B (CHEBI:66083) has functional parent angelic acid (CHEBI:36431) |
| interiotherin B (CHEBI:66083) has role anti-HIV agent (CHEBI:64946) |
| interiotherin B (CHEBI:66083) has role metabolite (CHEBI:25212) |
| interiotherin B (CHEBI:66083) is a aromatic ether (CHEBI:35618) |
| interiotherin B (CHEBI:66083) is a fatty acid ester (CHEBI:35748) |
| interiotherin B (CHEBI:66083) is a lignan (CHEBI:25036) |
| interiotherin B (CHEBI:66083) is a organic heteropentacyclic compound (CHEBI:38164) |
| interiotherin B (CHEBI:66083) is a oxacycle (CHEBI:38104) |
| Synonym | Source |
|---|---|
| 2-Butenoic acid, 2-methyl-, (5S,6S,7S,13aS)-5,6,7,8-tetrahydro-6-hydroxy-13,14-dimethoxy-6,7-dimethylcycloocta(1,2-f:3,4-f')bis(1,3)benzodioxol-5-yl ester, (2Z)- | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9305287 | Reaxys |
| CAS:181701-07-5 | ChemIDplus |
| Citations |
|---|