EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)C(=CC1=O)CC[C@@H](OC(=O)/C(C)=C\C)[C@@H]2C |
| InChI | InChI=1S/C20H28O3/c1-7-13(4)19(22)23-18-9-8-15-10-17(21)16(12(2)3)11-20(15,6)14(18)5/h7,10,14,16,18H,2,8-9,11H2,1,3-6H3/b13-7-/t14-,16-,18+,20+/m0/s1 |
| InChIKey | ISTBXSFGFOYLTM-NZEDGPFZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.11.31 {[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase} activator Any compound that binds to and activates the enzyme [hydroxymethylglutaryl-CoA reductase (NADPH)] kinase (EC 2.7.11.31). |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| petasin (CHEBI:8030) has functional parent angelic acid (CHEBI:36431) |
| petasin (CHEBI:8030) has role anti-allergic agent (CHEBI:50857) |
| petasin (CHEBI:8030) has role EC 2.7.11.31 {[hydroxymethylglutaryl-CoA reductase (NADPH)] kinase} activator (CHEBI:85053) |
| petasin (CHEBI:8030) has role plant metabolite (CHEBI:76924) |
| petasin (CHEBI:8030) has role vasodilator agent (CHEBI:35620) |
| petasin (CHEBI:8030) is a alicyclic ketone (CHEBI:36132) |
| petasin (CHEBI:8030) is a enoate ester (CHEBI:51702) |
| petasin (CHEBI:8030) is a enone (CHEBI:51689) |
| petasin (CHEBI:8030) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1R,2R,7S,8aR)-1,8a-dimethyl-6-oxo-7-(prop-1-en-2-yl)-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl (2Z)-2-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| (+)-Petasin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2419978 | Reaxys |
| CAS:26577-85-5 | ChemIDplus |
| CAS:26577-85-5 | KEGG COMPOUND |
| Citations |
|---|