EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31NO7 |
| Net Charge | 0 |
| Average Mass | 397.468 |
| Monoisotopic Mass | 397.21005 |
| SMILES | [H][C@]12C(COC(=O)[C@](O)([C@H](C)O)C(C)(C)O)=CCN1CC[C@@H]2OC(=O)/C(C)=C\C |
| InChI | InChI=1S/C20H31NO7/c1-6-12(2)17(23)28-15-8-10-21-9-7-14(16(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6-7,13,15-16,22,25-26H,8-11H2,1-5H3/b12-6-/t13-,15-,16+,20+/m0/s1 |
| InChIKey | HRSGCYGUWHGOPY-UKLMUADPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heliosupine (CHEBI:5641) has functional parent angelic acid (CHEBI:36431) |
| heliosupine (CHEBI:5641) has functional parent isocrotonic acid (CHEBI:36253) |
| heliosupine (CHEBI:5641) is a 2-methylbut-2-enoic acid (CHEBI:36432) |
| heliosupine (CHEBI:5641) is a azabicycloalkane (CHEBI:38295) |
| heliosupine (CHEBI:5641) is a diester (CHEBI:51307) |
| IUPAC Name |
|---|
| (1S,7aR)-7-[({(2S)-2,3-dihydroxy-2-[(1S)-1-hydroxyethyl]-3-methylbutanoyl}oxy)methyl]-2,3,5,7a-tetrahydro-1H-pyrrolo[1,2-a]pyrrol-1-yl (2Z)-2-methylbut-2-enoate |
| Synonyms | Source |
|---|---|
| Heliosupine | KEGG COMPOUND |
| 7-Angelyl-9-echimidinylheliotridine | KEGG COMPOUND |
| Cynoglossofin | ChemIDplus |
| Cynoglossofine | ChemIDplus |
| Cynoglossophine | ChemIDplus |
| Heliosupin | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| CAS:32728-78-2 | KEGG COMPOUND |
| CAS:32728-78-2 | ChemIDplus |
| CAS:32728-78-2 | NIST Chemistry WebBook |