EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40O10 |
| Net Charge | 0 |
| Average Mass | 584.662 |
| Monoisotopic Mass | 584.26215 |
| SMILES | C/C=C(/C)C(=O)O[C@H]1c2cc(OC)c(OC)c(OC)c2-c2c(cc3c(c2OC)OCO3)[C@H](OC(=O)CCC)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C32H40O10/c1-10-12-23(33)41-26-17(4)18(5)27(42-32(34)16(3)11-2)19-13-21(35-6)28(36-7)30(37-8)24(19)25-20(26)14-22-29(31(25)38-9)40-15-39-22/h11,13-14,17-18,26-27H,10,12,15H2,1-9H3/b16-11-/t17-,18+,26-,27-/m1/s1 |
| InChIKey | YWOQCMUIZIFGSH-NWTVNDALSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura ananosma (ncbitaxon:133441) | seed (BTO:0001226) | PubMed (21381710) | 70% aqueous acetone extract of air-dried and powdered seeds, biphenyl configuration is S |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ananolignan N (CHEBI:67451) has functional parent angelic acid (CHEBI:36431) |
| ananolignan N (CHEBI:67451) has role metabolite (CHEBI:25212) |
| ananolignan N (CHEBI:67451) has role plant metabolite (CHEBI:76924) |
| ananolignan N (CHEBI:67451) is a aromatic ether (CHEBI:35618) |
| ananolignan N (CHEBI:67451) is a butyrate ester (CHEBI:50477) |
| ananolignan N (CHEBI:67451) is a enoate ester (CHEBI:51702) |
| ananolignan N (CHEBI:67451) is a lignan (CHEBI:25036) |
| ananolignan N (CHEBI:67451) is a organic heterotetracyclic compound (CHEBI:38163) |
| ananolignan N (CHEBI:67451) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (5R,6S,7R,8R)-8-(butyryloxy)-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21534269 | Reaxys |
| Citations |
|---|