EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O2 |
| Net Charge | 0 |
| Average Mass | 86.090 |
| Monoisotopic Mass | 86.03678 |
| SMILES | [H]/C(C)=C/C(=O)O |
| InChI | InChI=1S/C4H6O2/c1-2-3-4(5)6/h2-3H,1H3,(H,5,6)/b3-2- |
| InChIKey | LDHQCZJRKDOVOX-IHWYPQMZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isocrotonic acid (CHEBI:36253) is a 2-butenoic acid (CHEBI:17217) |
| isocrotonic acid (CHEBI:36253) is conjugate acid of isocrotonate (CHEBI:36254) |
| Incoming Relation(s) |
| angelic acid (CHEBI:36431) has functional parent isocrotonic acid (CHEBI:36253) |
| ethyl (2Z)-but-2-enoate (CHEBI:87334) has functional parent isocrotonic acid (CHEBI:36253) |
| heliosupine (CHEBI:5641) has functional parent isocrotonic acid (CHEBI:36253) |
| isocrotonate (CHEBI:36254) is conjugate base of isocrotonic acid (CHEBI:36253) |
| IUPAC Name |
|---|
| (2Z)-but-2-enoic acid |
| Synonyms | Source |
|---|---|
| cis-Crotonic Acid | NIST Chemistry WebBook |
| cis-2-Butenoic Acid | NIST Chemistry WebBook |
| (Z)-Crotonic acid | NIST Chemistry WebBook |
| (Z)-2-Butenoic acid | NIST Chemistry WebBook |
| perisocrotonic acid | ChEBI |
| (Z)-but-2-enoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030194 | LIPID MAPS |