EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O10 |
| Net Charge | 0 |
| Average Mass | 556.608 |
| Monoisotopic Mass | 556.23085 |
| SMILES | C/C=C(/C)C(=O)O[C@H]1c2cc(OC)c(OC)c(OC)c2-c2c(cc3c(c2OC)OCO3)[C@H](OC(C)=O)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C30H36O10/c1-10-14(2)30(32)40-25-16(4)15(3)24(39-17(5)31)19-12-21-27(38-13-37-21)29(36-9)23(19)22-18(25)11-20(33-6)26(34-7)28(22)35-8/h10-12,15-16,24-25H,13H2,1-9H3/b14-10-/t15-,16+,24-,25-/m1/s1 |
| InChIKey | HIGLJZHMTBHEQS-HWZXAUMYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura ananosma (ncbitaxon:133441) | seed (BTO:0001226) | PubMed (21381710) | 70% aqueous acetone extract of air-dried and powdered seeds, biphenyl configuration is S |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| interiotherin C (CHEBI:67455) has functional parent angelic acid (CHEBI:36431) |
| interiotherin C (CHEBI:67455) has role metabolite (CHEBI:25212) |
| interiotherin C (CHEBI:67455) has role neuroprotective agent (CHEBI:63726) |
| interiotherin C (CHEBI:67455) is a acetate ester (CHEBI:47622) |
| interiotherin C (CHEBI:67455) is a aromatic ether (CHEBI:35618) |
| interiotherin C (CHEBI:67455) is a fatty acid ester (CHEBI:35748) |
| interiotherin C (CHEBI:67455) is a lignan (CHEBI:25036) |
| interiotherin C (CHEBI:67455) is a organic heterotetracyclic compound (CHEBI:38163) |
| interiotherin C (CHEBI:67455) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| (5R,6S,7R,8R)-8-(acetyloxy)-1,2,3,13-tetramethoxy-6,7-dimethyl-5,6,7,8-tetrahydrobenzo[3',4']cycloocta[1',2':4,5]benzo[1,2-d][1,3]dioxol-5-yl (2Z)-2-methylbut-2-enoate |
| Synonym | Source |
|---|---|
| 2-Butenoic acid, 2-methyl-, (5R,6S,7R,8R,13aS)-8-(acetyloxy)-5,6,7,8-tetrahydro-1,2,3,13-tetramethoxy-6,7-dimethylbenzo(3,4)cycloocta(1,2-f)(1,3)benzodioxol-5-ylester, (2Z)- | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9306694 | Reaxys |
| CAS:460090-65-7 | ChemIDplus |
| Citations |
|---|