EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12 |
| Net Charge | 0 |
| Average Mass | 192.261 |
| Monoisotopic Mass | 192.09390 |
| SMILES | C1=Cc2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C15H12/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-10H,11H2 |
| InChIKey | QPJORFLSOJAUNL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenzo[a,d][7]annulene (CHEBI:35642) is a dibenzannulene (CHEBI:35641) |
| Incoming Relation(s) |
| 1-(2,4-dichloro-10,11-dihydrodibenzo[a,d][7]annulen-5-yl)imidazole (CHEBI:83584) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| amineptine (CHEBI:32499) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| amitriptyline (CHEBI:2666) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| cyclobenzaprine (CHEBI:3996) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| cyclobenzaprine hydrochloride (CHEBI:3997) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| nortriptyline (CHEBI:7640) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| protriptyline (CHEBI:8597) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| IUPAC Name |
|---|
| 5H-dibenzo[a,d][7]annulene |
| Synonym | Source |
|---|---|
| 5H-dibenzo[a,d]cycloheptene | ChEBI |