EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO2 |
| Net Charge | 0 |
| Average Mass | 337.463 |
| Monoisotopic Mass | 337.20418 |
| SMILES | O=C(O)CCCCCCNC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C22H27NO2/c24-21(25)13-3-1-2-8-16-23-22-19-11-6-4-9-17(19)14-15-18-10-5-7-12-20(18)22/h4-7,9-12,22-23H,1-3,8,13-16H2,(H,24,25) |
| InChIKey | ONNOFKFOZAJDHT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amineptine (CHEBI:32499) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| amineptine (CHEBI:32499) has role antidepressant (CHEBI:35469) |
| amineptine (CHEBI:32499) has role dopamine uptake inhibitor (CHEBI:51039) |
| amineptine (CHEBI:32499) is a amino acid (CHEBI:33709) |
| amineptine (CHEBI:32499) is a carbocyclic fatty acid (CHEBI:35744) |
| amineptine (CHEBI:32499) is a carbotricyclic compound (CHEBI:38032) |
| amineptine (CHEBI:32499) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| amineptine hydrochloride (CHEBI:50003) has part amineptine (CHEBI:32499) |
| IUPAC Name |
|---|
| 7-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylamino)heptanoic acid |
| INNs | Source |
|---|---|
| amineptine | ChemIDplus |
| amineptino | ChemIDplus |
| amineptinum | ChemIDplus |
| amineptine | WHO MedNet |
| Synonym | Source |
|---|---|
| Amineptin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Survector | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2170218 | Reaxys |
| CAS:57574-09-1 | ChemIDplus |
| CAS:57574-09-1 | NIST Chemistry WebBook |
| Citations |
|---|