EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO2 |
| Net Charge | 0 |
| Average Mass | 337.463 |
| Monoisotopic Mass | 337.20418 |
| SMILES | O=C(O)CCCCCCNC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C22H27NO2/c24-21(25)13-3-1-2-8-16-23-22-19-11-6-4-9-17(19)14-15-18-10-5-7-12-20(18)22/h4-7,9-12,22-23H,1-3,8,13-16H2,(H,24,25) |
| InChIKey | ONNOFKFOZAJDHT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Applications: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amineptine (CHEBI:32499) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| amineptine (CHEBI:32499) has role antidepressant (CHEBI:35469) |
| amineptine (CHEBI:32499) has role dopamine uptake inhibitor (CHEBI:51039) |
| amineptine (CHEBI:32499) is a amino acid (CHEBI:33709) |
| amineptine (CHEBI:32499) is a carbocyclic fatty acid (CHEBI:35744) |
| amineptine (CHEBI:32499) is a carbotricyclic compound (CHEBI:38032) |
| amineptine (CHEBI:32499) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| amineptine hydrochloride (CHEBI:50003) has part amineptine (CHEBI:32499) |
| IUPAC Name |
|---|
| 7-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylamino)heptanoic acid |
| INNs | Source |
|---|---|
| amineptine | WHO MedNet |
| amineptine | ChemIDplus |
| amineptino | ChemIDplus |
| amineptinum | ChemIDplus |
| Synonym | Source |
|---|---|
| Amineptin | ChemIDplus |
| Brand Name | Source |
|---|---|
| Survector | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2170218 | Reaxys |
| CAS:57574-09-1 | ChemIDplus |
| CAS:57574-09-1 | NIST Chemistry WebBook |
| Citations |
|---|