EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N |
| Net Charge | 0 |
| Average Mass | 263.384 |
| Monoisotopic Mass | 263.16740 |
| SMILES | CNCCCC1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C19H21N/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3 |
| InChIKey | BWPIARFWQZKAIA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protriptyline (CHEBI:8597) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| protriptyline (CHEBI:8597) has role antidepressant (CHEBI:35469) |
| protriptyline (CHEBI:8597) is a carbotricyclic compound (CHEBI:38032) |
| Incoming Relation(s) |
| protriptyline hydrochloride (CHEBI:8598) has part protriptyline (CHEBI:8597) |
| IUPAC Name |
|---|
| 3-(5H-dibenzo[a,d][7]annulen-5-yl)-N-methylpropan-1-amine |
| Synonyms | Source |
|---|---|
| Protriptyline | KEGG COMPOUND |
| N-methyl-5H-dibenzo[a,d]cycloheptene-5-propylamine | NIST Chemistry WebBook |
| 7-(3-methylaminopropyl)-1,2:5,6-dibenzocycloheptatriene | ChemIDplus |
| 5-(3-methylaminopropyl)-5H-dibenzo[a,d]cycloheptene | NIST Chemistry WebBook |
| amimetilina | ChemIDplus |
| 3-(5H-dibenzo[a,d]cyclohepten-5-yl)-N-methyl-1-propanamine | NIST Chemistry WebBook |
| Citations |
|---|