EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N |
| Net Charge | 0 |
| Average Mass | 275.395 |
| Monoisotopic Mass | 275.16740 |
| SMILES | CN(C)CCC=C1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C20H21N/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20/h3-6,8-14H,7,15H2,1-2H3 |
| InChIKey | JURKNVYFZMSNLP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. tranquilizing drug A traditional grouping of drugs said to have a soothing or calming effect on mood, thought or behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclobenzaprine (CHEBI:3996) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| cyclobenzaprine (CHEBI:3996) has role antidepressant (CHEBI:35469) |
| cyclobenzaprine (CHEBI:3996) has role muscle relaxant (CHEBI:51371) |
| cyclobenzaprine (CHEBI:3996) has role tranquilizing drug (CHEBI:35473) |
| cyclobenzaprine (CHEBI:3996) is a carbotricyclic compound (CHEBI:38032) |
| Incoming Relation(s) |
| cyclobenzaprine hydrochloride (CHEBI:3997) has part cyclobenzaprine (CHEBI:3996) |
| IUPAC Names |
|---|
| 3-(5H-dibenzo[a,d][7]annulen-5-ylidene)-N,N-dimethylpropan-1-amine |
| 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropan-1-amine |
| INNs | Source |
|---|---|
| ciclobenzaprina | ChemIDplus |
| cyclobenzaprine | ChemIDplus |
| cyclobenzaprinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (3-Dibenzo[a,d]cyclohepten-5-ylidene-propyl)-dimethyl-amine | ChEMBL |
| Cyclobenzaprine | KEGG COMPOUND |
| N,N-dimethyl-5H-dibenzo(a,d)cycloheptene-Δ5,γ-propylamine | NIST Chemistry WebBook |
| Citations |
|---|