EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N.HCl |
| Net Charge | 0 |
| Average Mass | 311.856 |
| Monoisotopic Mass | 311.14408 |
| SMILES | CN(C)CCC=C1c2ccccc2C=Cc2ccccc21.Cl |
| InChI | InChI=1S/C20H21N.ClH/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-14H,7,15H2,1-2H3;1H |
| InChIKey | VXEAYBOGHINOKW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclobenzaprine hydrochloride (CHEBI:3997) has parent hydride dibenzo[a,d][7]annulene (CHEBI:35642) |
| cyclobenzaprine hydrochloride (CHEBI:3997) has part cyclobenzaprine (CHEBI:3996) |
| cyclobenzaprine hydrochloride (CHEBI:3997) has role antidepressant (CHEBI:35469) |
| cyclobenzaprine hydrochloride (CHEBI:3997) has role muscle relaxant (CHEBI:51371) |
| cyclobenzaprine hydrochloride (CHEBI:3997) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 3-(5H-dibenzo[a,d][7]annulen-5-ylidene)-N,N-dimethylpropan-1-amine hydrochloride |
| 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropan-1-amine hydrochloride |
| Synonyms | Source |
|---|---|
| cyclobenzaprine HCl | ChemIDplus |
| N,N-dimethyl-5H-dibenzo(a,d)cycloheptene-Δ5,γ-propylamine hydrochloride | ChemIDplus |