EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H21N3O2S |
| Net Charge | 0 |
| Average Mass | 295.408 |
| Monoisotopic Mass | 295.13545 |
| SMILES | CNS(=O)(=O)Cc1ccc2ncc(CCN(C)C)c2c1 |
| InChI | InChI=1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3 |
| InChIKey | KQKPFRSPSRPDEB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sumatriptan (CHEBI:10650) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| sumatriptan (CHEBI:10650) has role serotonergic agonist (CHEBI:35941) |
| sumatriptan (CHEBI:10650) has role vasoconstrictor agent (CHEBI:50514) |
| sumatriptan (CHEBI:10650) is a sulfonamide (CHEBI:35358) |
| sumatriptan (CHEBI:10650) is a tryptamines (CHEBI:27162) |
| sumatriptan (CHEBI:10650) is conjugate base of sumatriptan(1+) (CHEBI:64364) |
| Incoming Relation(s) |
| sumatriptan(1+) (CHEBI:64364) is conjugate acid of sumatriptan (CHEBI:10650) |
| IUPAC Name |
|---|
| 1-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-N-methylmethanesulfonamide |
| INNs | Source |
|---|---|
| sumatriptan | ChEBI |
| sumatriptan | KEGG DRUG |
| sumatriptán | ChEBI |
| sumatriptanum | ChEBI |
| Synonyms | Source |
|---|---|
| 1-[3-(2-dimethylaminoethyl)-1H-indol-5-yl]-N-methyl-methanesulfonamide | IUPHAR |
| (3-[2-(dimethylamino)ethyl]-1H-indol-5-yl)-N-methylmethanesulfonamide | NIST Chemistry WebBook |
| 3-(2-(dimethylamino)ethyl)-N-methyl-1H-indole-5-methanesulfonamide | ChemIDplus |
| 3-[2-(dimethylamino)ethyl]-N-methylindole-5-methanesulfonamide | NIST Chemistry WebBook |
| Sumatran | DrugBank |
| Sumax | DrugBank |
| Brand Names | Source |
|---|---|
| Imigran | KEGG DRUG |
| Imitrex | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2543 | DrugCentral |
| C07319 | KEGG COMPOUND |
| D00451 | KEGG DRUG |
| DB00669 | DrugBank |
| HMDB0005037 | HMDB |
| LSM-5618 | LINCS |
| Sumatriptan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5346011 | Reaxys |
| CAS:103628-46-2 | KEGG COMPOUND |
| CAS:103628-46-2 | ChemIDplus |
| CAS:103628-46-2 | NIST Chemistry WebBook |
| Citations |
|---|