EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3210 - bufotenin
| Formula | C12H16N2O |
| Net Charge | 0 |
| Average Mass | 204.273 |
| Monoisotopic Mass | 204.12626 |
| SMILES | CN(C)CCc1cnc2ccc(O)cc12 |
| InChI | InChI=1S/C12H16N2O/c1-14(2)6-5-9-8-13-12-4-3-10(15)7-11(9)12/h3-4,7-8,13,15H,5-6H2,1-2H3 |
| InChIKey | VTTONGPRPXSUTJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paramuricea clavata (ncbitaxon:317549) | - | PubMed (21939218) | CH2Cl2:MeOH(1:1) extract of lyophilized material |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bufotenin (CHEBI:3210) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| bufotenin (CHEBI:3210) has role coral metabolite (CHEBI:76498) |
| bufotenin (CHEBI:3210) has role hallucinogen (CHEBI:35499) |
| bufotenin (CHEBI:3210) is a tertiary amine (CHEBI:32876) |
| bufotenin (CHEBI:3210) is a tryptamine alkaloid (CHEBI:48274) |
| Incoming Relation(s) |
| 5-methoxy-N,N-dimethyltryptamine (CHEBI:2086) has functional parent bufotenin (CHEBI:3210) |
| IUPAC Name |
|---|
| 3-[2-(dimethylamino)ethyl]-1H-indol-5-ol |
| Synonyms | Source |
|---|---|
| 3-[2-(dimethylamino)ethyl]-5-indolol | NIST Chemistry WebBook |
| 3-[2-(dimethylamino)ethyl]indol-5-ol | NIST Chemistry WebBook |
| 3-[β-(dimethylamino)ethyl]-5-hydroxyindole | NIST Chemistry WebBook |
| 5-hydroxy-N,N-dimethyltryptamine | ChemIDplus |
| Bufotenin | KEGG COMPOUND |
| Bufotenine | KEGG COMPOUND |
| Citations |
|---|