EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8613 - psilocin
| Formula | C12H16N2O |
| Net Charge | 0 |
| Average Mass | 204.273 |
| Monoisotopic Mass | 204.12626 |
| SMILES | CN(C)CCc1cnc2cccc(O)c12 |
| InChI | InChI=1S/C12H16N2O/c1-14(2)7-6-9-8-13-10-4-3-5-11(15)12(9)10/h3-5,8,13,15H,6-7H2,1-2H3 |
| InChIKey | SPCIYGNTAMCTRO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psilocin (CHEBI:8613) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| psilocin (CHEBI:8613) has role drug metabolite (CHEBI:49103) |
| psilocin (CHEBI:8613) has role fungal metabolite (CHEBI:76946) |
| psilocin (CHEBI:8613) has role hallucinogen (CHEBI:35499) |
| psilocin (CHEBI:8613) has role human xenobiotic metabolite (CHEBI:76967) |
| psilocin (CHEBI:8613) has role serotonergic agonist (CHEBI:35941) |
| psilocin (CHEBI:8613) is a hydroxyindoles (CHEBI:84729) |
| psilocin (CHEBI:8613) is a phenols (CHEBI:33853) |
| psilocin (CHEBI:8613) is a tertiary amino compound (CHEBI:50996) |
| psilocin (CHEBI:8613) is a tryptamine alkaloid (CHEBI:48274) |
| psilocin (CHEBI:8613) is conjugate base of psilocinium (CHEBI:193059) |
| Incoming Relation(s) |
| psilocybin (CHEBI:8614) has functional parent psilocin (CHEBI:8613) |
| psilocinium (CHEBI:193059) is conjugate acid of psilocin (CHEBI:8613) |
| IUPAC Name |
|---|
| 3-[2-(dimethylamino)ethyl]-1H-indol-4-ol |
| Synonyms | Source |
|---|---|
| Psilocin | KEGG COMPOUND |
| N,N-dimethyl-4-hydroxytryptamine | NIST Chemistry WebBook |
| 4-hydroxy-N,N-dimethyltryptamine | ChemIDplus |
| Psilotsin | HMDB |
| 3-(2-(Dimethylamino)ethyl)indol-4-ol | HMDB |
| Psilocine | HMDB |
| Citations |
|---|