EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N5 |
| Net Charge | 0 |
| Average Mass | 269.352 |
| Monoisotopic Mass | 269.16405 |
| SMILES | CN(C)CCc1cnc2ccc(Cn3cncn3)cc12 |
| InChI | InChI=1S/C15H19N5/c1-19(2)6-5-13-8-17-15-4-3-12(7-14(13)15)9-20-11-16-10-18-20/h3-4,7-8,10-11,17H,5-6,9H2,1-2H3 |
| InChIKey | ULFRLSNUDGIQQP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. anti-inflammatory drug A substance that reduces or suppresses inflammation. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rizatriptan (CHEBI:48273) has functional parent N,N-dimethyltryptamine (CHEBI:28969) |
| rizatriptan (CHEBI:48273) has role anti-inflammatory drug (CHEBI:35472) |
| rizatriptan (CHEBI:48273) has role serotonergic agonist (CHEBI:35941) |
| rizatriptan (CHEBI:48273) has role vasoconstrictor agent (CHEBI:50514) |
| rizatriptan (CHEBI:48273) is a tryptamines (CHEBI:27162) |
| IUPAC Name |
|---|
| N,N-dimethyl-2-[5-(1H-1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine |
| INNs | Source |
|---|---|
| rizatriptan | ChEBI |
| rizatriptan | ChemIDplus |
| rizatriptán | ChEBI |
| rizatriptanum | ChEBI |
| Synonyms | Source |
|---|---|
| N,N-dimethyl-2-[5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]-ethanamine | IUPHAR |
| N,N-dimethyl-5-(1H-1,2,4-triazol-1-ylmethyl)-1H-indole-3-ethanamine | ChemIDplus |
| MK 462 free base | ChemIDplus |
| risatriptan | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2393 | DrugCentral |
| DB00953 | DrugBank |
| LSM-3691 | LINCS |
| Rizatriptan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7078976 | Beilstein |
| CAS:144034-80-0 | ChemIDplus |