EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O4 |
| Net Charge | 0 |
| Average Mass | 254.241 |
| Monoisotopic Mass | 254.05791 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H |
| InChIKey | ZQSIJRDFPHDXIC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daidzein (CHEBI:28197) has role antineoplastic agent (CHEBI:35610) |
| daidzein (CHEBI:28197) has role EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor (CHEBI:131699) |
| daidzein (CHEBI:28197) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| daidzein (CHEBI:28197) has role phytoestrogen (CHEBI:76989) |
| daidzein (CHEBI:28197) has role plant metabolite (CHEBI:76924) |
| daidzein (CHEBI:28197) is a 7-hydroxyisoflavones (CHEBI:55465) |
| daidzein (CHEBI:28197) is conjugate acid of daidzein(1−) (CHEBI:77764) |
| Incoming Relation(s) |
| 2'-hydroxy-2,3-dihydrodaidzein (CHEBI:16035) has functional parent daidzein (CHEBI:28197) |
| 2'-hydroxydaidzein (CHEBI:27479) has functional parent daidzein (CHEBI:28197) |
| 3',4',7-trihydroxyisoflavone (CHEBI:50399) has functional parent daidzein (CHEBI:28197) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has functional parent daidzein (CHEBI:28197) |
| 8-prenyldaidzein (CHEBI:133373) has functional parent daidzein (CHEBI:28197) |
| daidzein 7-(6-O-acetyl-β-D-glucoside) (CHEBI:133395) has functional parent daidzein (CHEBI:28197) |
| daidzein 7-O-β-D-glucoside (CHEBI:42202) has functional parent daidzein (CHEBI:28197) |
| daidzein monosulfate (CHEBI:133579) has functional parent daidzein (CHEBI:28197) |
| formononetin (CHEBI:18088) has functional parent daidzein (CHEBI:28197) |
| isoformononetin (CHEBI:29608) has functional parent daidzein (CHEBI:28197) |
| daidzein(1−) (CHEBI:77764) is conjugate base of daidzein (CHEBI:28197) |
| IUPAC Name |
|---|
| 7-hydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',7-dihydroxyisoflavone | ChemIDplus |
| 4',7-dihydroxyisoflavone | ChEBI |
| 7,4'-dihydroxyisoflavone | ChemIDplus |
| 7-Hydroxy-3-(4-hydroxyphenyl)-4-benzopyrone | ChEBI |
| 7-hydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ChemIDplus |
| Daidzein | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00009380 | KNApSAcK |
| C10208 | KEGG COMPOUND |
| C10208 | KEGG COMPOUND |
| Daidzein | Wikipedia |
| DAIDZEIN | MetaCyc |
| HMDB0003312 | HMDB |
| LMPK12050038 | LIPID MAPS |
| LSM-2935 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:231523 | Reaxys |
| CAS:486-66-8 | ChemIDplus |
| CAS:486-66-8 | KEGG COMPOUND |
| Citations |
|---|