EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O9 |
| Net Charge | 0 |
| Average Mass | 416.382 |
| Monoisotopic Mass | 416.11073 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KYQZWONCHDNPDP-QNDFHXLGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | - | PubMed (25236207) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daidzein 7-O-β-D-glucoside (CHEBI:42202) has functional parent daidzein (CHEBI:28197) |
| daidzein 7-O-β-D-glucoside (CHEBI:42202) has role plant metabolite (CHEBI:76924) |
| daidzein 7-O-β-D-glucoside (CHEBI:42202) is a 7-hydroxyisoflavones 7-O-β-D-glucoside (CHEBI:140301) |
| daidzein 7-O-β-D-glucoside (CHEBI:42202) is a hydroxyisoflavone (CHEBI:38755) |
| daidzein 7-O-β-D-glucoside (CHEBI:42202) is a monosaccharide derivative (CHEBI:63367) |
| Incoming Relation(s) |
| malonyldaidzin (CHEBI:80371) has functional parent daidzein 7-O-β-D-glucoside (CHEBI:42202) |
| IUPAC Names |
|---|
| 3-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-7-yl β-D-glucopyranoside |
| 7-(β-D-glucopyranosyloxy)-3-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| daidzein 7-O-glucoside | ChemIDplus |
| daidzein 7-glucoside | ChemIDplus |
| Daidzein 7-O-glucoside | KEGG COMPOUND |
| Daidzin | KEGG COMPOUND |
| DAIDZIN | PDBeChem |
| daidzoside | ChemIDplus |
| UniProt Name | Source |
|---|---|
| daidzein 7-O-β-D-glucoside | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002518 | KNApSAcK |
| C10216 | KEGG COMPOUND |
| CPD-3424 | MetaCyc |
| Daidzin | Wikipedia |
| DB02115 | DrugBank |
| DZN | PDBeChem |
| HMDB0033991 | HMDB |
| LMPK12050013 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:59741 | Reaxys |
| Beilstein:59741 | Beilstein |
| CAS:552-66-9 | ChemIDplus |
| CAS:552-66-9 | KEGG COMPOUND |
| Citations |
|---|