EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O4 |
| Net Charge | 0 |
| Average Mass | 268.268 |
| Monoisotopic Mass | 268.07356 |
| SMILES | COc1ccc(-c2coc3cc(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3 |
| InChIKey | HKQYGTCOTHHOMP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| formononetin (CHEBI:18088) has functional parent daidzein (CHEBI:28197) |
| formononetin (CHEBI:18088) has role phytoestrogen (CHEBI:76989) |
| formononetin (CHEBI:18088) has role plant metabolite (CHEBI:76924) |
| formononetin (CHEBI:18088) is a 4'-methoxyisoflavones (CHEBI:133959) |
| formononetin (CHEBI:18088) is a 7-hydroxyisoflavones (CHEBI:55465) |
| formononetin (CHEBI:18088) is conjugate acid of formononetin(1−) (CHEBI:77688) |
| Incoming Relation(s) |
| 2'-hydroxyformononetin (CHEBI:17678) has functional parent formononetin (CHEBI:18088) |
| formononetin 7-O-glucoside-6''-O-malonate (CHEBI:80389) has functional parent formononetin (CHEBI:18088) |
| formononetin 7-O-rutinoside (CHEBI:85135) has functional parent formononetin (CHEBI:18088) |
| ononin (CHEBI:7775) has functional parent formononetin (CHEBI:18088) |
| formononetin(1−) (CHEBI:77688) is conjugate base of formononetin (CHEBI:18088) |
| IUPAC Name |
|---|
| 7-hydroxy-3-(4-methoxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Formononetin | KEGG COMPOUND |
| 7-hydroxy-3-(4-methoxyphenyl)-4H-benzopyran-4-one | ChEBI |
| biochanin B | ChEBI |
| 4'-O-methyldaidzein | ChEBI |
| formononetol | ChEBI |
| 7-Hydroxy-4'-methoxyisoflavone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00858 | KEGG COMPOUND |
| FORMONONETIN | MetaCyc |
| LMPK12050037 | LIPID MAPS |
| Formononetin | Wikipedia |
| C00002525 | KNApSAcK |
| HMDB0005808 | HMDB |
| LSM-19000 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1288158 | Beilstein |
| Reaxys:237979 | Reaxys |
| CAS:485-72-3 | KEGG COMPOUND |
| Citations |
|---|