EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-14-6-13(18)12(17)5-10(14)15(11)19/h1-7,16-18H |
| InChIKey | GYLUFQJZYAJQDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has functional parent daidzein (CHEBI:28197) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has role anti-inflammatory agent (CHEBI:67079) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has role antimutagen (CHEBI:73190) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has role metabolite (CHEBI:25212) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has role PPARα agonist (CHEBI:70782) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) has role PPARγ agonist (CHEBI:71554) |
| 4',6,7-trihydroxyisoflavone (CHEBI:74957) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 6,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 6,7,4'-trihydroxyisoflavone | MetaCyc |
| 6-Hydroxydaidzein | HMDB |
| 6-Hydroxydaidzein | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00009385 | KNApSAcK |
| C14314 | KEGG COMPOUND |
| CPD-6998 | MetaCyc |
| HMDB0031715 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1291621 | Reaxys |
| CAS:17817-31-1 | ChemIDplus |
| CAS:17817-31-1 | KEGG COMPOUND |
| Citations |
|---|