EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77764 - daidzein(1−)
| Formula | C15H9O4 |
| Net Charge | -1 |
| Average Mass | 253.233 |
| Monoisotopic Mass | 253.05063 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc([O-])ccc12 |
| InChI | InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H/p-1 |
| InChIKey | ZQSIJRDFPHDXIC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daidzein(1−) (CHEBI:77764) has role antineoplastic agent (CHEBI:35610) |
| daidzein(1−) (CHEBI:77764) has role EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor (CHEBI:131699) |
| daidzein(1−) (CHEBI:77764) has role phytoestrogen (CHEBI:76989) |
| daidzein(1−) (CHEBI:77764) has role plant metabolite (CHEBI:76924) |
| daidzein(1−) (CHEBI:77764) is a flavonoid oxoanion (CHEBI:60038) |
| daidzein(1−) (CHEBI:77764) is conjugate base of daidzein (CHEBI:28197) |
| Incoming Relation(s) |
| daidzein (CHEBI:28197) is conjugate acid of daidzein(1−) (CHEBI:77764) |
| IUPAC Name |
|---|
| 3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-olate |
| UniProt Name | Source |
|---|---|
| daidzein | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DAIDZEIN | MetaCyc |
| Citations |
|---|