EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)ccc12 |
| InChI | InChI=1S/C15H10O5/c16-9-2-3-10-14(6-9)20-7-11(15(10)19)8-1-4-12(17)13(18)5-8/h1-7,16-18H |
| InChIKey | DDKGKOOLFLYZDL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of of 3-oxo-5α-steroid 4-dehydrogenase (NADP+), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5α-dihydrotestosterone. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',4',7-trihydroxyisoflavone (CHEBI:50399) has functional parent daidzein (CHEBI:28197) |
| 3',4',7-trihydroxyisoflavone (CHEBI:50399) has role antineoplastic agent (CHEBI:35610) |
| 3',4',7-trihydroxyisoflavone (CHEBI:50399) has role EC 1.3.1.22 [3-oxo-5α-steroid 4-dehydrogenase (NADP+)] inhibitor (CHEBI:50781) |
| 3',4',7-trihydroxyisoflavone (CHEBI:50399) has role metabolite (CHEBI:25212) |
| 3',4',7-trihydroxyisoflavone (CHEBI:50399) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-7-hydroxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 3',4',7-trihydroxyisoflavone | ChemIDplus |
| 3-(3,4-dihydroxyphenyl)-7-hydroxy-4H-1-benzopyran-4-one | ChemIDplus |
| 3',4',7-Trihydroxyisoflavone | KEGG COMPOUND |
| 3'-hydroxydaidzein | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14313 | KEGG COMPOUND |
| LMPK12050055 | LIPID MAPS |
| HMDB0041655 | HMDB |
| C00009384 | KNApSAcK |
| 47X | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:251800 | Beilstein |
| Reaxys:251800 | Reaxys |
| CAS:485-63-2 | ChemIDplus |
| CAS:485-63-2 | KEGG COMPOUND |
| Citations |
|---|