EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O4 |
| Net Charge | 0 |
| Average Mass | 322.360 |
| Monoisotopic Mass | 322.12051 |
| SMILES | CC(C)=CCc1c(O)ccc2c(=O)c(-c3ccc(O)cc3)coc12 |
| InChI | InChI=1S/C20H18O4/c1-12(2)3-8-15-18(22)10-9-16-19(23)17(11-24-20(15)16)13-4-6-14(21)7-5-13/h3-7,9-11,21-22H,8H2,1-2H3 |
| InChIKey | NQKCBBHHFITUFF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bituminaria bituminosa (ncbitaxon:53836) | aerial part (BTO:0001658) | PubMed (12943781) | |
| Bituminaria morisiana (IPNI:942911-1) | aerial part (BTO:0001658) | PubMed (12943781) | |
| Cullen corylifolium (ncbitaxon:429560) | fruit (BTO:0000486) | PubMed (20663508) | |
| Erythrina fusca (ncbitaxon:556509) | stem wood (BTO:0001469) | PubMed (18404327) | |
| Erythrina variegata (ncbitaxon:3845) | root (BTO:0001188) | PubMed (10869220) | Isolated from the root bark |
| Glycine max (ncbitaxon:3847) | |||
| seed (BTO:0001226) | MetaboLights (MTBLS117) | ||
| seed (BTO:0001226) | MetaboLights (MTBLS118) | ||
| seed (BTO:0001226) | PubMed (25369450) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-prenyldaidzein (CHEBI:133373) has functional parent daidzein (CHEBI:28197) |
| 8-prenyldaidzein (CHEBI:133373) has role plant metabolite (CHEBI:76924) |
| 8-prenyldaidzein (CHEBI:133373) is a 7-hydroxyisoflavones (CHEBI:55465) |
| 8-prenyldaidzein (CHEBI:133373) is a olefinic compound (CHEBI:78840) |
| 8-prenyldaidzein (CHEBI:133373) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 7-hydroxy-3-(4-hydroxyphenyl)-8-(3-methylbut-2-en-1-yl)-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| 23550835 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4758879 | Reaxys |
| Citations |
|---|