EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:2676 - amoxicillin
| Formula | C16H19N3O5S |
| Net Charge | 0 |
| Average Mass | 365.411 |
| Monoisotopic Mass | 365.10454 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10-,11+,14-/m1/s1 |
| InChIKey | LSQZJLSUYDQPKJ-NJBDSQKTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicillin (CHEBI:2676) has role antibacterial drug (CHEBI:36047) |
| amoxicillin (CHEBI:2676) is a penicillin (CHEBI:17334) |
| amoxicillin (CHEBI:2676) is a penicillin allergen (CHEBI:88187) |
| amoxicillin (CHEBI:2676) is conjugate acid of amoxicillin(1−) (CHEBI:51256) |
| Incoming Relation(s) |
| amoxicillin diketopiperazine (CHEBI:60639) has functional parent amoxicillin (CHEBI:2676) |
| amoxicilloyl polylysine (CHEBI:133951) has functional parent amoxicillin (CHEBI:2676) |
| amoxicilloyl-L-lysine (CHEBI:139366) has functional parent amoxicillin (CHEBI:2676) |
| amoxicilloyl-butylamine (CHEBI:55470) has functional parent amoxicillin (CHEBI:2676) |
| amoxicillin trihydrate (CHEBI:51254) has part amoxicillin (CHEBI:2676) |
| amoxicillin(1−) (CHEBI:51256) is conjugate base of amoxicillin (CHEBI:2676) |
| amoxicillanyl group (CHEBI:53712) is substituent group from amoxicillin (CHEBI:2676) |
| amoxicilloyl group (CHEBI:53705) is substituent group from amoxicillin (CHEBI:2676) |
| ampicillanyl group (CHEBI:53713) is substituent group from amoxicillin (CHEBI:2676) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-amino-2-(4-hydroxyphenyl)acetamido]-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| amoxicillin | KEGG DRUG |
| amoxicilina | ChemIDplus |
| amoxicillinum | ChemIDplus |
| amoxicilline | ChemIDplus |
| Synonyms | Source |
|---|---|
| Amoxicillin | KEGG COMPOUND |
| Amoxicillin anhydrous | KEGG COMPOUND |
| amoxycillin | ChemIDplus |
| (2S,5R,6R)-6-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| p-hydroxyampicillin | ChemIDplus |
| α-amino-p-hydroxybenzylpenicillin | ChemIDplus |
| Brand Names | Source |
|---|---|
| Clamoxyl | ChemIDplus |
| AMPC | DrugBank |
| Amolin | DrugBank |
| Amopenixin | DrugBank |
| Moxal | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4274654 | Reaxys |
| CAS:26787-78-0 | KEGG COMPOUND |
| CAS:26787-78-0 | ChemIDplus |
| Citations |
|---|