EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N3O5S |
| Net Charge | -1 |
| Average Mass | 364.403 |
| Monoisotopic Mass | 364.09727 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)[O-])N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/p-1/t9-,10-,11+,14-/m1/s1 |
| InChIKey | LSQZJLSUYDQPKJ-NJBDSQKTSA-M |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicillin(1−) (CHEBI:51256) is a penicillinate anion (CHEBI:51356) |
| amoxicillin(1−) (CHEBI:51256) is conjugate base of amoxicillin (CHEBI:2676) |
| Incoming Relation(s) |
| amoxicillin sodium (CHEBI:51255) has part amoxicillin(1−) (CHEBI:51256) |
| amoxicillin (CHEBI:2676) is conjugate acid of amoxicillin(1−) (CHEBI:51256) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-amino-2-(4-hydroxyphenyl)acetamido]-2,2-dimethylpenam-3α-carboxylate |
| Synonym | Source |
|---|---|
| (2S,5R,6R)-6-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6077298 | Beilstein |