EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N3O5S |
| Net Charge | 0 |
| Average Mass | 366.419 |
| Monoisotopic Mass | 366.11237 |
| SMILES | *C(=O)[C@@H](NC(=O)[C@H](N)c1ccc(O)cc1)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicilloyl group (CHEBI:53705) has role antibacterial agent (CHEBI:33282) |
| amoxicilloyl group (CHEBI:53705) is a penicilloyl group (CHEBI:88224) |
| amoxicilloyl group (CHEBI:53705) is a penicilloyl group allergen (CHEBI:88223) |
| amoxicilloyl group (CHEBI:53705) is a univalent carboacyl group (CHEBI:27207) |
| amoxicilloyl group (CHEBI:53705) is substituent group from amoxicillin (CHEBI:2676) |
| Incoming Relation(s) |
| amoxicilloyl-L-lysine (CHEBI:139366) has part amoxicilloyl group (CHEBI:53705) |
| amoxicilloyl-benzylamine (CHEBI:55440) has part amoxicilloyl group (CHEBI:53705) |
| IUPAC Name |
|---|
| (2R)-2-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-2-[(2R,4S)-4-carboxy-5,5-dimethyl-1,3-thiazolidin-2-yl]acetyl |
| Synonyms | Source |
|---|---|
| amoxicilloyl | ChEBI |
| AXO | ChEBI |
| AMO | ChEBI |
| Citations |
|---|