EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N4O5S |
| Net Charge | 0 |
| Average Mass | 438.550 |
| Monoisotopic Mass | 438.19369 |
| SMILES | [H][C@@]1([C@H](NC(=O)[C@H](N)c2ccc(O)cc2)C(=O)NCCCC)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C20H30N4O5S/c1-4-5-10-22-17(27)14(18-24-15(19(28)29)20(2,3)30-18)23-16(26)13(21)11-6-8-12(25)9-7-11/h6-9,13-15,18,24-25H,4-5,10,21H2,1-3H3,(H,22,27)(H,23,26)(H,28,29)/t13-,14-,15+,18-/m1/s1 |
| InChIKey | SHISHHBVUCCUJC-ZXFNITATSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicilloyl-butylamine (CHEBI:55470) has functional parent amoxicillin (CHEBI:2676) |
| amoxicilloyl-butylamine (CHEBI:55470) is a monocarboxylic acid amide (CHEBI:29347) |
| amoxicilloyl-butylamine (CHEBI:55470) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| amoxicilloyl-butylamine (CHEBI:55470) is conjugate acid of amoxicilloyl-butylamine(1−) (CHEBI:133945) |
| Incoming Relation(s) |
| amoxicilloyl-butylamine(1−) (CHEBI:133945) is conjugate base of amoxicilloyl-butylamine (CHEBI:55470) |
| IUPAC Name |
|---|
| (2R,4S)-2-[(1R)-1-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-2-(butylamino)-2-oxoethyl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| AX-BA | ChEBI |
| AXO-BA | ChEBI |
| Citations |
|---|