EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O5S.3H2O |
| Net Charge | 0 |
| Average Mass | 419.456 |
| Monoisotopic Mass | 419.13624 |
| SMILES | O.O.O.[H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccc(O)cc1 |
| InChI | InChI=1S/C16H19N3O5S.3H2O/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;;;/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);3*1H2/t9-,10-,11+,14-;;;/m1.../s1 |
| InChIKey | MQXQVCLAUDMCEF-CWLIKTDRSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicillin trihydrate (CHEBI:51254) has part amoxicillin (CHEBI:2676) |
| amoxicillin trihydrate (CHEBI:51254) has role antibacterial drug (CHEBI:36047) |
| amoxicillin trihydrate (CHEBI:51254) has role antimicrobial agent (CHEBI:33281) |
| amoxicillin trihydrate (CHEBI:51254) is a hydrate (CHEBI:35505) |
| Incoming Relation(s) |
| Augmentin (CHEBI:2677) has part amoxicillin trihydrate (CHEBI:51254) |
| IUPAC Name |
|---|
| 6β-[(2R)-2-amino-2-(4-hydroxyphenyl)acetamido]-2,2-dimethylpenam-3α-carboxylic acid trihydrate |
| Brand Names | Source |
|---|---|
| Amoxipen | ChemIDplus |
| BRL 2333 | ChemIDplus |
| Clamoxyl | ChemIDplus |
| Larotid | ChemIDplus |
| Moxaline | ChemIDplus |
| Polymox | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7507120 | Beilstein |
| CAS:61336-70-7 | ChemIDplus |