EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O5S |
| Net Charge | 0 |
| Average Mass | 365.411 |
| Monoisotopic Mass | 365.10454 |
| SMILES | [H][C@@]1(C2NC(=O)C(c3ccc(O)cc3)NC2=O)N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-14(25-16)10-13(22)17-9(12(21)18-10)7-3-5-8(20)6-4-7/h3-6,9-11,14,19-20H,1-2H3,(H,17,22)(H,18,21)(H,23,24)/t9?,10?,11-,14+/m0/s1 |
| InChIKey | IIZCCQJEPBWGJU-YXLKDIQASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicillin diketopiperazine (CHEBI:60639) has functional parent amoxicillin (CHEBI:2676) |
| amoxicillin diketopiperazine (CHEBI:60639) has role allergen (CHEBI:50904) |
| amoxicillin diketopiperazine (CHEBI:60639) is a 2,5-diketopiperazines (CHEBI:65061) |
| amoxicillin diketopiperazine (CHEBI:60639) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| IUPAC Name |
|---|
| (2R,4S)-2-[5-(4-hydroxyphenyl)-3,6-dioxopiperazin-2-yl]-5,5-dimethyl-1,3-thiazolidine-4-carboxylic acid |
| Synonym | Source |
|---|---|
| amoxicillin 2,5-diketopiperazine | ChEBI |
| Citations |
|---|