EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C22H31N5O6S)n.(C6H12N2O)n.H4O2 |
| Net Charge | 0 |
| Average Mass | 657.791 |
| Monoisotopic Mass | 657.31560 |
| SMILES | [H]N[C@H](CCCCN)C(=O)O.[H]N[C@H](CCCCNC(=O)C(NC(=O)[C@H](N)c1ccc(O)cc1)[C@]1([H])N[C@@H](C(=O)O)C(C)(C)S1)C(=O)O |
| InChI | InChI=1S/C22H33N5O7S.C6H14N2O2/c1-22(2)16(21(33)34)27-19(35-22)15(18(30)25-10-4-3-5-13(23)20(31)32)26-17(29)14(24)11-6-8-12(28)9-7-11;7-4-2-1-3-5(8)6(9)10/h6-9,13-16,19,27-28H,3-5,10,23-24H2,1-2H3,(H,25,30)(H,26,29)(H,31,32)(H,33,34);5H,1-4,7-8H2,(H,9,10)/t13-,14-,15?,16+,19-;5-/m11/s1 |
| InChIKey | QOADWJDHTSAYJZ-QDNJCRFJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amoxicilloyl polylysine (CHEBI:133951) has functional parent amoxicillin (CHEBI:2676) |
| amoxicilloyl polylysine (CHEBI:133951) is a amino acid amide (CHEBI:22475) |
| amoxicilloyl polylysine (CHEBI:133951) is a polypeptide (CHEBI:15841) |
| amoxicilloyl polylysine (CHEBI:133951) is a random copolymer (CHEBI:53521) |
| amoxicilloyl polylysine (CHEBI:133951) is a thiazolidinemonocarboxylic acid (CHEBI:48875) |
| Synonyms | Source |
|---|---|
| AXO-PLL | ChEBI |
| amoxicilloyl-polylysine | ChEBI |
| amoxicilloyl-poly-L-lysine | ChEBI |
| Citations |
|---|