EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37NO5S |
| Net Charge | 0 |
| Average Mass | 439.618 |
| Monoisotopic Mass | 439.23924 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C23H37NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21(30-18-19(24)23(28)29)20(25)15-14-17-22(26)27/h6-7,9-13,16,19-21,25H,2-5,8,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29)/b7-6-,10-9-,12-11+,16-13+/t19-,20-,21+/m0/s1 |
| InChIKey | OTZRAYGBFWZKMX-FRFVZSDQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene E4 (CHEBI:15650) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene E4 (CHEBI:15650) is a L-cysteine thioether (CHEBI:27532) |
| leukotriene E4 (CHEBI:15650) is a amino dicarboxylic acid (CHEBI:36164) |
| leukotriene E4 (CHEBI:15650) is a leukotriene (CHEBI:25029) |
| leukotriene E4 (CHEBI:15650) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| leukotriene E4 (CHEBI:15650) is a secondary alcohol (CHEBI:35681) |
| leukotriene E4 (CHEBI:15650) is conjugate acid of leukotriene E4(1−) (CHEBI:57462) |
| Incoming Relation(s) |
| N-acetylleukotriene E4 (CHEBI:7210) has functional parent leukotriene E4 (CHEBI:15650) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) has functional parent leukotriene E4 (CHEBI:15650) |
| 16-carboxy-Δ13-17,18,19,20-tetranor-leukotriene E4 (CHEBI:74016) has functional parent leukotriene E4 (CHEBI:15650) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) has functional parent leukotriene E4 (CHEBI:15650) |
| 20-carboxyleukotriene E4 (CHEBI:134517) has functional parent leukotriene E4 (CHEBI:15650) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) has functional parent leukotriene E4 (CHEBI:15650) |
| 20-oxoleukotriene E4 (CHEBI:134513) has functional parent leukotriene E4 (CHEBI:15650) |
| leukotriene E4 methyl ester (CHEBI:138126) has functional parent leukotriene E4 (CHEBI:15650) |
| leukotriene E4(1−) (CHEBI:57462) is conjugate base of leukotriene E4 (CHEBI:15650) |
| IUPAC Names |
|---|
| (5S,6R,7E,9E,11Z,14Z)-6-(L-cystein-S-yl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| S-{(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxy-1-hydroxybutyl]pentadeca-2,4,6,9-tetraen-1-yl}-L-cysteine |
| Synonyms | Source |
|---|---|
| (5S-(5R*,6S*(S*),7E,9E,11Z,14Z))-6-((2-Amino-2-carboxyethyl)thio)-5-hydroxy-7,9,11,14-eicosatetraenoic acid | ChemIDplus |
| 5S-hydroxy,6R-(S-cysteinyl),7E,9E,11Z,14Z-eicosatetraenoic acid | LIPID MAPS |
| (7E,9E,11Z,14Z)-(5S,6R)-6-(Cystein-S-yl)-5-hydroxyeicosa-7,9,11,14-tetraenoate | KEGG COMPOUND |
| (7E,9E,11Z,14Z)-(5S,6R)-6-(Cystein-S-yl)-5-hydroxyicosa-7,9,11,14-tetraenoate | KEGG COMPOUND |
| Leukotriene E4 | KEGG COMPOUND |
| LTE4 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05952 | KEGG COMPOUND |
| LMFA03020002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:75715-89-8 | ChemIDplus |
| CAS:75715-89-8 | KEGG COMPOUND |
| Citations |
|---|