EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35NO6S |
| Net Charge | 0 |
| Average Mass | 453.601 |
| Monoisotopic Mass | 453.21851 |
| SMILES | [H]C(=O)CCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C23H35NO6S/c24-19(23(29)30)18-31-21(20(26)14-13-16-22(27)28)15-11-9-7-5-3-1-2-4-6-8-10-12-17-25/h2-5,7,9,11,15,17,19-21,26H,1,6,8,10,12-14,16,18,24H2,(H,27,28)(H,29,30)/b4-2-,5-3-,9-7+,15-11+/t19-,20-,21+/m0/s1 |
| InChIKey | DXFWBOQUFGDWDP-CMJQBAFXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-oxoleukotriene E4 (CHEBI:134513) has functional parent leukotriene E4 (CHEBI:15650) |
| 20-oxoleukotriene E4 (CHEBI:134513) is a L-cysteine thioether (CHEBI:27532) |
| 20-oxoleukotriene E4 (CHEBI:134513) is a aldehyde (CHEBI:17478) |
| 20-oxoleukotriene E4 (CHEBI:134513) is a amino dicarboxylic acid (CHEBI:36164) |
| 20-oxoleukotriene E4 (CHEBI:134513) is a leukotriene (CHEBI:25029) |
| 20-oxoleukotriene E4 (CHEBI:134513) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 20-oxoleukotriene E4 (CHEBI:134513) is a secondary alcohol (CHEBI:35681) |
| 20-oxoleukotriene E4 (CHEBI:134513) is conjugate acid of 20-oxoleukotriene E4(1−) (CHEBI:133433) |
| Incoming Relation(s) |
| 20-oxoleukotriene E4(1−) (CHEBI:133433) is conjugate base of 20-oxoleukotriene E4 (CHEBI:134513) |
| IUPAC Name |
|---|
| (5S,6R,7E,9E,11Z,14Z)-6-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-5-hydroxy-20-oxoicosa-7,9,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 20-oxo-LTE4 | ChEBI |
| 20-Oxo-leukotriene E4 | HMDB |
| 6-(S-Cysteinyl)-20-oxo-(5S)-hydroxy-(7E,9E,11Z,14Z)-eicosatetraenoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012642 | HMDB |