EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO7S |
| Net Charge | 0 |
| Average Mass | 441.546 |
| Monoisotopic Mass | 441.18212 |
| SMILES | [H][C@](N)(CS[C@H](/C=C/C=C/C=C\C/C=C\CCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H31NO7S/c22-16(21(28)29)15-30-18(17(23)11-10-14-20(26)27)12-8-6-4-2-1-3-5-7-9-13-19(24)25/h1-2,4-8,12,16-18,23H,3,9-11,13-15,22H2,(H,24,25)(H,26,27)(H,28,29)/b2-1-,6-4+,7-5-,12-8+/t16-,17-,18+/m0/s1 |
| InChIKey | OXCSBZDIZXLXRX-AVYHYKEVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) has functional parent leukotriene E4 (CHEBI:15650) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) has role metabolite (CHEBI:25212) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) is a L-cysteine thioether (CHEBI:27532) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) is a icosanoid (CHEBI:23899) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) is a secondary alcohol (CHEBI:35681) |
| 18-carboxy-19,20-dinor-leukotriene E4 (CHEBI:74017) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Names |
|---|
| (4Z,7Z,9E,11E,13R,14S)-13-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-14-hydroxyoctadeca-4,7,9,11-tetraenedioic acid |
| (4Z,7Z,9E,11E,13R,14S)-13-(L-cystein-S-yl)-14-hydroxyoctadeca-4,7,9,11-tetraenedioic acid |
| Synonyms | Source |
|---|---|
| 18-carboxy-19,20-dinor-LTE4 | ChEBI |
| 18-carboxy-19,20-dinor-LTE4 | ChEBI |
| 18-carboxy-dinor-leukotriene E4 | ChEBI |
| 18-carboxy-dinor-LTE4 | HMDB |
| 18-carboxy-dinor-LTE4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012607 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4588801 | Reaxys |
| Citations |
|---|