EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H37NO6S |
| Net Charge | 0 |
| Average Mass | 455.617 |
| Monoisotopic Mass | 455.23416 |
| SMILES | N[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCCO)[C@@H](O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H37NO6S/c24-19(23(29)30)18-31-21(20(26)14-13-16-22(27)28)15-11-9-7-5-3-1-2-4-6-8-10-12-17-25/h2-5,7,9,11,15,19-21,25-26H,1,6,8,10,12-14,16-18,24H2,(H,27,28)(H,29,30)/b4-2-,5-3-,9-7+,15-11+/t19-,20-,21+/m0/s1 |
| InChIKey | BJRMBXPQAMDCMG-CMJQBAFXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) has functional parent leukotriene E4 (CHEBI:15650) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) is a L-cysteine thioether (CHEBI:27532) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) is a amino dicarboxylic acid (CHEBI:36164) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) is a primary alcohol (CHEBI:15734) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) is a secondary alcohol (CHEBI:35681) |
| 20-hydroxy-leukotriene E4 (CHEBI:28700) is conjugate acid of 20-hydroxy-leukotriene E4(1−) (CHEBI:58584) |
| Incoming Relation(s) |
| 20-hydroxy-leukotriene E4(1−) (CHEBI:58584) is conjugate base of 20-hydroxy-leukotriene E4 (CHEBI:28700) |
| IUPAC Names |
|---|
| (5S,6R,7E,9E,11Z,14Z)-6-(cystein-S-yl)-5,20-dihydroxyicosa-7,9,11,14-tetraenoic acid |
| S-{(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxy-1-hydroxybutyl]-15-hydroxypentadeca-2,4,6,9-tetraen-1-yl}-L-cysteine |
| Synonyms | Source |
|---|---|
| 20-hydroxy-leukotriene E4 | ChEBI |
| 20-Hydroxy-leukotriene E4 | KEGG COMPOUND |
| 20-OH-Leukotriene E4 | KEGG COMPOUND |
| 20-OH-LTE4 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03577 | KEGG COMPOUND |
| LMFA03020025 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:111844-33-8 | KEGG COMPOUND |