EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35NO7S |
| Net Charge | 0 |
| Average Mass | 469.600 |
| Monoisotopic Mass | 469.21342 |
| SMILES | N[C@@H](CS[C@H](/C=C/C=C/C=C\C/C=C\CCCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H35NO7S/c24-18(23(30)31)17-32-20(19(25)13-12-16-22(28)29)14-10-8-6-4-2-1-3-5-7-9-11-15-21(26)27/h2-6,8,10,14,18-20,25H,1,7,9,11-13,15-17,24H2,(H,26,27)(H,28,29)(H,30,31)/b4-2-,5-3-,8-6+,14-10+/t18-,19-,20+/m0/s1 |
| InChIKey | HVLRBLGTGJGVCX-SKJZCNKWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-carboxyleukotriene E4 (CHEBI:134517) has functional parent leukotriene E4 (CHEBI:15650) |
| 20-carboxyleukotriene E4 (CHEBI:134517) is a L-cysteine thioether (CHEBI:27532) |
| 20-carboxyleukotriene E4 (CHEBI:134517) is a leukotriene (CHEBI:25029) |
| 20-carboxyleukotriene E4 (CHEBI:134517) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 20-carboxyleukotriene E4 (CHEBI:134517) is a secondary alcohol (CHEBI:35681) |
| 20-carboxyleukotriene E4 (CHEBI:134517) is a tricarboxylic acid (CHEBI:27093) |
| 20-carboxyleukotriene E4 (CHEBI:134517) is conjugate acid of 20-carboxyleukotriene E4(2−) (CHEBI:133439) |
| Incoming Relation(s) |
| 20-carboxyleukotriene E4(2−) (CHEBI:133439) is conjugate base of 20-carboxyleukotriene E4 (CHEBI:134517) |
| IUPAC Name |
|---|
| (6Z,9Z,11E,13E,15R,16S)-15-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-16-hydroxyicosa-6,9,11,13-tetraenedioic acid |
| Synonyms | Source |
|---|---|
| 20-carboxy-leukotriene E4 | ChEBI |
| 20-carboxy-LTE4 | ChEBI |
| 20-COOH-leukotriene E4 | ChEBI |
| 20-COOH-LTE4 | HMDB |
| 6-(S-Cysteinyl)-(5S)-hydroxy-(7E,9E,11Z,14Z)-eicosatetraenedioic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0012634 | HMDB |