EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H]C(=CCC([H])=CCCCCC)C=C([H])C=C([H])CCCCCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-14H,2-5,8,15-19H2,1H3,(H,21,22) |
| InChIKey | CDCGSBZGVNFCSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) is a icosatetraenoic acid (CHEBI:36033) |
| Incoming Relation(s) |
| (5S,6S)-dihydroxy-(7E,9E,11Z,14Z)-icosatetraenoic acid (CHEBI:53026) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| 11-trans-LTE4 (CHEBI:72779) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| BAYu9773 (CHEBI:167654) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene A4 (CHEBI:15651) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene C4 (CHEBI:16978) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene D4 (CHEBI:28666) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene E4 (CHEBI:15650) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| leukotriene F4 (CHEBI:27491) has functional parent icosa-7,9,11,14-tetraenoic acid (CHEBI:36038) |
| IUPAC Name |
|---|
| icosa-7,9,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 7,9,11,14-18:4 | ChEBI |
| 7,9,11,14-eicosatetraenoic acid | ChEBI |
| 7,9,11,14-eicosatetraenoic acids | ChEBI |
| 7,9,11,14-icosatetraenoic acid | ChEBI |
| 7,9,11,14-icosatetraenoic acids | ChEBI |
| C18:4 n-6,9,11,13 | ChEBI |