EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29NO7S |
| Net Charge | 0 |
| Average Mass | 415.508 |
| Monoisotopic Mass | 415.16647 |
| SMILES | N[C@@H](CS[C@H](/C=C/C=C/C=C\CCCC(=O)O)[C@@H](O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H29NO7S/c20-14(19(26)27)13-28-16(15(21)9-8-12-18(24)25)10-6-4-2-1-3-5-7-11-17(22)23/h1-4,6,10,14-16,21H,5,7-9,11-13,20H2,(H,22,23)(H,24,25)(H,26,27)/b3-1-,4-2+,10-6+/t14-,15-,16+/m0/s1 |
| InChIKey | LDJCPGIDJQSRGG-XFJBKEMKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) has functional parent leukotriene E4 (CHEBI:15650) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) has role metabolite (CHEBI:25212) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) is a L-cysteine thioether (CHEBI:27532) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) is a icosanoid (CHEBI:23899) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) is a secondary alcohol (CHEBI:35681) |
| 16-carboxy-17,18,19,20-tetranor-leukotriene E3 (CHEBI:74014) is a tricarboxylic acid (CHEBI:27093) |
| IUPAC Names |
|---|
| (5Z,7E,9E,11R,12S)-11-(L-cystein-S-yl)-12-hydroxyhexadeca-5,7,9-trienedioic acid |
| (5Z,7E,9E,11R,12S)-11-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-12-hydroxyhexadeca-5,7,9-trienedioic acid |
| Synonyms | Source |
|---|---|
| 15-carboxy-14,15-dihydro-16,17,18,19,20-pentanor-leukotriene E4 | ChEBI |
| 16-carboxy-14,15-dihydro-17,18,19,20-tetranor-LTE4 | ChEBI |
| 16-carboxy-14,15-dihydro-17,18,19,20-tetranor-LTE4 | ChEBI |
| 16-carboxy-tetranor-LTE3 | ChEBI |
| 16-carboxy-tetranor-LTE3 | ChEBI |
| 16-carboxy-tetranor-leukotriene E3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4577467 | Reaxys |
| CAS:122069-63-0 | Reaxys |
| Citations |
|---|