EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36NO5S |
| Net Charge | -1 |
| Average Mass | 438.610 |
| Monoisotopic Mass | 438.23197 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H]([NH3+])C(=O)[O-])[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C23H37NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21(30-18-19(24)23(28)29)20(25)15-14-17-22(26)27/h6-7,9-13,16,19-21,25H,2-5,8,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29)/p-1/b7-6-,10-9-,12-11+,16-13+/t19-,20-,21+/m0/s1 |
| InChIKey | OTZRAYGBFWZKMX-FRFVZSDQSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene E4(1−) (CHEBI:57462) has role human metabolite (CHEBI:77746) |
| leukotriene E4(1−) (CHEBI:57462) is a dicarboxylic acid anion (CHEBI:35693) |
| leukotriene E4(1−) (CHEBI:57462) is a leukotriene anion (CHEBI:62942) |
| leukotriene E4(1−) (CHEBI:57462) is conjugate base of leukotriene E4 (CHEBI:15650) |
| Incoming Relation(s) |
| leukotriene E4 (CHEBI:15650) is conjugate acid of leukotriene E4(1−) (CHEBI:57462) |
| IUPAC Names |
|---|
| S-{(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxy-1-hydroxybutyl]pentadeca-2,4,6,9-tetraen-1-yl}-L-cysteinium |
| (5S,6R,7E,9E,11Z,14Z)-6-(cysteinium-S-yl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| Synonym | Source |
|---|---|
| leukotriene E4 anion | ChEBI |
| UniProt Name | Source |
|---|---|
| leukotriene E4 | UniProt |