EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH3NO2 |
| Net Charge | 0 |
| Average Mass | 61.040 |
| Monoisotopic Mass | 61.01638 |
| SMILES | NC(=O)O |
| InChI | InChI=1S/CH3NO2/c2-1(3)4/h2H2,(H,3,4) |
| InChIKey | KXDHJXZQYSOELW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbamic acid (CHEBI:28616) has role Escherichia coli metabolite (CHEBI:76971) |
| carbamic acid (CHEBI:28616) is a carbon oxoacid (CHEBI:35605) |
| carbamic acid (CHEBI:28616) is a one-carbon compound (CHEBI:64708) |
| carbamic acid (CHEBI:28616) is a organonitrogen compound (CHEBI:35352) |
| carbamic acid (CHEBI:28616) is conjugate acid of carbamate (CHEBI:13941) |
| Incoming Relation(s) |
| (hydroxymethyl)carbamic acid (CHEBI:185681) has functional parent carbamic acid (CHEBI:28616) |
| 1-carboxybiuret (CHEBI:143024) has functional parent carbamic acid (CHEBI:28616) |
| 1,3-dicarboxyurea (CHEBI:142879) has functional parent carbamic acid (CHEBI:28616) |
| 5-carboxyamino-1-(5-phospho-D-ribosyl)imidazole (CHEBI:48000) has functional parent carbamic acid (CHEBI:28616) |
| carbamate ester (CHEBI:23003) has functional parent carbamic acid (CHEBI:28616) |
| chlorphenesin carbamate (CHEBI:3643) has functional parent carbamic acid (CHEBI:28616) |
| dimethylcarbamic acid (CHEBI:38544) has functional parent carbamic acid (CHEBI:28616) |
| Dimethylcarbamoyl chloride (CHEBI:82280) has functional parent carbamic acid (CHEBI:28616) |
| hexylcarbamic acid (CHEBI:156060) has functional parent carbamic acid (CHEBI:28616) |
| isopropylcarbamic acid (CHEBI:747602) has functional parent carbamic acid (CHEBI:28616) |
| methylcarbamic acid (CHEBI:45379) has functional parent carbamic acid (CHEBI:28616) |
| phenylcarbamic acid (CHEBI:52496) has functional parent carbamic acid (CHEBI:28616) |
| piperazine-1-carboxylic acid (CHEBI:41221) has functional parent carbamic acid (CHEBI:28616) |
| carbamate (CHEBI:13941) is conjugate base of carbamic acid (CHEBI:28616) |
| carbamoyl group (CHEBI:23004) is substituent group from carbamic acid (CHEBI:28616) |
| carboxyamino group (CHEBI:37017) is substituent group from carbamic acid (CHEBI:28616) |
| IUPAC Name |
|---|
| carbamic acid |
| Synonyms | Source |
|---|---|
| Aminoameisensäure | ChEBI |
| Aminoformic acid | KEGG COMPOUND |
| Carbamate | KEGG COMPOUND |
| Carbamic acid | KEGG COMPOUND |
| CARBAMIC ACID | PDBeChem |
| Carbamidsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01563 | KEGG COMPOUND |
| Carbamic_acid | Wikipedia |
| DB04261 | DrugBank |
| OUT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Gmelin:130345 | Gmelin |
| Beilstein:1734754 | Beilstein |
| CAS:463-77-4 | KEGG COMPOUND |
| CAS:463-77-4 | ChemIDplus |