EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO2 |
| Net Charge | 0 |
| Average Mass | 137.138 |
| Monoisotopic Mass | 137.04768 |
| SMILES | O=C(O)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NO2/c9-7(10)8-6-4-2-1-3-5-6/h1-5,8H,(H,9,10) |
| InChIKey | PWXJULSLLONQHY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylcarbamic acid (CHEBI:52496) has functional parent carbamic acid (CHEBI:28616) |
| phenylcarbamic acid (CHEBI:52496) is a amino acid (CHEBI:33709) |
| Incoming Relation(s) |
| carbetamide (CHEBI:3394) has functional parent phenylcarbamic acid (CHEBI:52496) |
| desmedipham (CHEBI:81733) has functional parent phenylcarbamic acid (CHEBI:52496) |
| IUPAC Name |
|---|
| phenylcarbamic acid |
| Synonyms | Source |
|---|---|
| Carbanilic acid | ChemIDplus |
| Carbanilsaeure | ChemIDplus |
| Phenylcarbamidsaeure | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2802524 | Beilstein |
| CAS:501-82-6 | ChemIDplus |