EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H5NO3 |
| Net Charge | 0 |
| Average Mass | 91.066 |
| Monoisotopic Mass | 91.02694 |
| SMILES | O=C(O)NCO |
| InChI | InChI=1S/C2H5NO3/c4-1-3-2(5)6/h3-4H,1H2,(H,5,6) |
| InChIKey | AWMWFDZRWWNCQN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (hydroxymethyl)carbamic acid (CHEBI:185681) has functional parent carbamic acid (CHEBI:28616) |
| (hydroxymethyl)carbamic acid (CHEBI:185681) is a amino acid (CHEBI:33709) |
| IUPAC Name |
|---|
| hydroxymethylcarbamic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0143414 | HMDB |
| 11190357 | ChemSpider |