EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2 |
| Net Charge | 0 |
| Average Mass | 145.202 |
| Monoisotopic Mass | 145.11028 |
| SMILES | CCCCCCNC(=O)O |
| InChI | InChI=1S/C7H15NO2/c1-2-3-4-5-6-8-7(9)10/h8H,2-6H2,1H3,(H,9,10) |
| InChIKey | YAQPZDICKJDHTR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexylcarbamic acid (CHEBI:156060) has functional parent carbamic acid (CHEBI:28616) |
| hexylcarbamic acid (CHEBI:156060) is a amino acid (CHEBI:33709) |
| IUPAC Name |
|---|
| hexylcarbamic acid |
| Synonym | Source |
|---|---|
| N-hexylcarbamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| JRY | PDBeChem |
| Citations |
|---|