EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12ClNO4 |
| Net Charge | 0 |
| Average Mass | 245.662 |
| Monoisotopic Mass | 245.04549 |
| SMILES | NC(=O)OCC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO4/c11-7-1-3-9(4-2-7)15-5-8(13)6-16-10(12)14/h1-4,8,13H,5-6H2,(H2,12,14) |
| InChIKey | SKPLBLUECSEIFO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorphenesin carbamate (CHEBI:3643) has functional parent carbamic acid (CHEBI:28616) |
| chlorphenesin carbamate (CHEBI:3643) has functional parent chlorphenesin (CHEBI:3642) |
| chlorphenesin carbamate (CHEBI:3643) has role antineoplastic agent (CHEBI:35610) |
| chlorphenesin carbamate (CHEBI:3643) has role muscle relaxant (CHEBI:51371) |
| chlorphenesin carbamate (CHEBI:3643) is a carbamate ester (CHEBI:23003) |
| chlorphenesin carbamate (CHEBI:3643) is a monochlorobenzenes (CHEBI:83403) |
| chlorphenesin carbamate (CHEBI:3643) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 3-(4-chlorophenoxy)-2-hydroxypropyl carbamate |
| Synonyms | Source |
|---|---|
| 1,2-propanediol-3-(p-chlorophenoxy)-1-carbamate | ChEBI |
| 3-(4-chlorophenoxy)-1,2-propanediol-1-carbamate | ChemIDplus |
| 3-(p-chlorophenoxy)-1,2-propanediol 1-carbamate | ChemIDplus |
| 3-(p-chlorophenoxy)-2-hydroxypropyl carbamate | ChemIDplus |
| carbamic acid 3-(p-chlorophenoxy)-2-hydroxypropyl ester | ChEBI |
| Chlorphenesin carbamate | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Maolate | ChEMBL |
| Citations |
|---|