EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2 |
| Net Charge | 0 |
| Average Mass | 89.094 |
| Monoisotopic Mass | 89.04768 |
| SMILES | CN(C)C(=O)O |
| InChI | InChI=1S/C3H7NO2/c1-4(2)3(5)6/h1-2H3,(H,5,6) |
| InChIKey | DWLVWMUCHSLGSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylcarbamic acid (CHEBI:38544) has functional parent carbamic acid (CHEBI:28616) |
| dimethylcarbamic acid (CHEBI:38544) is a amino acid (CHEBI:33709) |
| Incoming Relation(s) |
| pirimicarb (CHEBI:8248) has functional parent dimethylcarbamic acid (CHEBI:38544) |
| IUPAC Name |
|---|
| dimethylcarbamic acid |
| Synonym | Source |
|---|---|
| N,N-dimethylcarbamic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1920740 | Reaxys |
| CAS:7260-94-8 | ChemIDplus |